C33H32N4O4 — CID 69450239
(E)-4-oxo-4-[4-[[2-phenyl-4-[[(1S)-1-phenylethyl]carbamoyl]quinolin-3-yl]methyl]piperazin-1-yl]but-2-enoic acid (PubChem CID 69450239) has the molecular formula C33H32N4O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[[2-phenyl-4-[[(1S)-1-phenylethyl]carbamoyl]quinolin-3-yl]methyl]piperazin-1-yl]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[[2-phenyl-4-[[(1S)-1-phenylethyl]carbamoyl]quinolin-3-yl]methyl]piperazin-1-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 69450239 |
| Molecular Formula | C33H32N4O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | (E)-4-oxo-4-[4-[[2-phenyl-4-[[(1S)-1-phenylethyl]carbamoyl]quinolin-3-yl]methyl]piperazin-1-yl]but-2-enoic acid |
| SMILES | C[C@H](NC(=O)c1c(CN2CCN(C(=O)/C=C/C(=O)O)CC2)c(-c2ccccc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C33H32N4O4/c1-23(24-10-4-2-5-11-24)34-33(41)31-26-14-8-9-15-28(26)35-32(25-12-6-3-7-13-25)27(31)22-36-18-20-37(21-19-36)29(38)16-17-30(39)40/h2-17,23H,18-22H2,1H3,(H,34,41)(H,39,40)/b17-16+/t23-/m0/s1 |
| InChIKey | SCWVFAKUEFKMGD-OFYULWLWSA-N |
| XLogP | 4.68 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|