C20H23N3O2 — CID 69451896
1-(3-ethoxyphenyl)-3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]urea (PubChem CID 69451896) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]urea.
| Compound Name | 1-(3-ethoxyphenyl)-3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 69451896 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-(3-ethoxyphenyl)-3-[4-(1,2,3,6-tetrahydropyridin-4-yl)phenyl]urea |
| SMILES | CCOc1cccc(NC(=O)Nc2ccc(C3=CCNCC3)cc2)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-25-19-5-3-4-18(14-19)23-20(24)22-17-8-6-15(7-9-17)16-10-12-21-13-11-16/h3-10,14,21H,2,11-13H2,1H3,(H2,22,23,24) |
| InChIKey | ISOBPPSUNGDLDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |