C30H46N2O4Si — CID 69453388
1-[2,5-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-2-[4-hydroxy-4-(6-methoxy-3-pyridinyl)piperidin-1-yl]ethanone (PubChem CID 69453388) has the molecular formula C30H46N2O4Si and a molecular weight of 526.79 g/mol. Its IUPAC name is 1-[2,5-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-2-[4-hydroxy-4-(6-methoxy-3-pyridinyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[2,5-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-2-[4-hydroxy-4-(6-methoxy-3-pyridinyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 69453388 |
| Molecular Formula | C30H46N2O4Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 1-[2,5-dimethyl-4-tri(propan-2-yl)silyloxyphenyl]-2-[4-hydroxy-4-(6-methoxy-3-pyridinyl)piperidin-1-yl]ethanone |
| SMILES | COc1ccc(C2(O)CCN(CC(=O)c3cc(C)c(O[Si](C(C)C)(C(C)C)C(C)C)cc3C)CC2)cn1 |
| InChI | InChI=1S/C30H46N2O4Si/c1-20(2)37(21(3)4,22(5)6)36-28-17-23(7)26(16-24(28)8)27(33)19-32-14-12-30(34,13-15-32)25-10-11-29(35-9)31-18-25/h10-11,16-18,20-22,34H,12-15,19H2,1-9H3 |
| InChIKey | QXKUCUSNEUXNTL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|