C23H19F3N2O4S — CID 69453522
3,3-dimethyl-1-(4-nitrophenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]-2H-indole (PubChem CID 69453522) has the molecular formula C23H19F3N2O4S and a molecular weight of 476.48 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-nitrophenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]-2H-indole.
| Compound Name | 3,3-dimethyl-1-(4-nitrophenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]-2H-indole |
|---|---|
| PubChem CID | 69453522 |
| Molecular Formula | C23H19F3N2O4S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 3,3-dimethyl-1-(4-nitrophenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]-2H-indole |
| SMILES | CC1(C)c2ccccc2N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19F3N2O4S/c1-22(2)19-8-3-4-9-20(19)27(21(22)15-6-5-7-16(14-15)23(24,25)26)33(31,32)18-12-10-17(11-13-18)28(29)30/h3-14,21H,1-2H3 |
| InChIKey | MRORBRQEDXKZSB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|