C15H23ClNO2+ — CID 6945380
[(2S)-3-(4-chlorophenoxy)-2-methylpropyl]-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 6945380) has the molecular formula C15H23ClNO2+ and a molecular weight of 284.81 g/mol. Its IUPAC name is [(2S)-3-(4-chlorophenoxy)-2-methylpropyl]-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [(2S)-3-(4-chlorophenoxy)-2-methylpropyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 6945380 |
| Molecular Formula | C15H23ClNO2+ |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [(2S)-3-(4-chlorophenoxy)-2-methylpropyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | C[C@@H](C[NH2+]C[C@H]1CCCO1)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO2/c1-12(9-17-10-15-3-2-8-18-15)11-19-14-6-4-13(16)5-7-14/h4-7,12,15,17H,2-3,8-11H2,1H3/p+1/t12-,15+/m0/s1 |
| InChIKey | RVHYXQDPSBHFRM-SWLSCSKDSA-O |
| XLogP | 2.10 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |