C15H19ClNO2+ — CID 7379066
4-(4-chlorophenoxy)but-2-ynyl-[[(2S)-oxolan-2-yl]methyl]azanium (PubChem CID 7379066) has the molecular formula C15H19ClNO2+ and a molecular weight of 280.77 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)but-2-ynyl-[[(2S)-oxolan-2-yl]methyl]azanium.
| Compound Name | 4-(4-chlorophenoxy)but-2-ynyl-[[(2S)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7379066 |
| Molecular Formula | C15H19ClNO2+ |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-(4-chlorophenoxy)but-2-ynyl-[[(2S)-oxolan-2-yl]methyl]azanium |
| SMILES | Clc1ccc(OCC#CC[NH2+]C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C15H18ClNO2/c16-13-5-7-14(8-6-13)18-10-2-1-9-17-12-15-4-3-11-19-15/h5-8,15,17H,3-4,9-12H2/p+1/t15-/m0/s1 |
| InChIKey | SFRVGFANGITNGW-HNNXBMFYSA-O |
| XLogP | 1.46 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|