C21H18FNO2S — CID 69453906
[(3S)-1-(1-benzothiophene-2-carbonyl)piperidin-3-yl]-(4-fluorophenyl)methanone (PubChem CID 69453906) has the molecular formula C21H18FNO2S and a molecular weight of 367.45 g/mol. Its IUPAC name is [(3S)-1-(1-benzothiophene-2-carbonyl)piperidin-3-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(3S)-1-(1-benzothiophene-2-carbonyl)piperidin-3-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 69453906 |
| Molecular Formula | C21H18FNO2S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [(3S)-1-(1-benzothiophene-2-carbonyl)piperidin-3-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)[C@H]1CCCN(C(=O)c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C21H18FNO2S/c22-17-9-7-14(8-10-17)20(24)16-5-3-11-23(13-16)21(25)19-12-15-4-1-2-6-18(15)26-19/h1-2,4,6-10,12,16H,3,5,11,13H2/t16-/m0/s1 |
| InChIKey | HCYPCAVOOVWQNM-INIZCTEOSA-N |
| XLogP | 4.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |