C16H12Cl2N2O2S — CID 69454734
methyl 2-[(5,6-dichloro-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 69454734) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is methyl 2-[(5,6-dichloro-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 2-[(5,6-dichloro-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 69454734 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | methyl 2-[(5,6-dichloro-1H-benzimidazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CSc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H12Cl2N2O2S/c1-22-15(21)10-5-3-2-4-9(10)8-23-16-19-13-6-11(17)12(18)7-14(13)20-16/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | RVJALMBTTJQOKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |