C28H40F3NO3Si — CID 69455176
2-[2-[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-2-hydroxyethyl]-4-(3-fluorophenyl)piperidin-4-ol (PubChem CID 69455176) has the molecular formula C28H40F3NO3Si and a molecular weight of 523.71 g/mol. Its IUPAC name is 2-[2-[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-2-hydroxyethyl]-4-(3-fluorophenyl)piperidin-4-ol.
| Compound Name | 2-[2-[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-2-hydroxyethyl]-4-(3-fluorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 69455176 |
| Molecular Formula | C28H40F3NO3Si |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 2-[2-[2,5-difluoro-4-tri(propan-2-yl)silyloxyphenyl]-2-hydroxyethyl]-4-(3-fluorophenyl)piperidin-4-ol |
| SMILES | CC(C)[Si](Oc1cc(F)c(C(O)CC2CC(O)(c3cccc(F)c3)CCN2)cc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H40F3NO3Si/c1-17(2)36(18(3)4,19(5)6)35-27-15-24(30)23(14-25(27)31)26(33)13-22-16-28(34,10-11-32-22)20-8-7-9-21(29)12-20/h7-9,12,14-15,17-19,22,26,32-34H,10-11,13,16H2,1-6H3 |
| InChIKey | QIYDKFZTEHBKSK-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|