C23H19BrNNaO4 — CID 69455323
sodium 6-[2-[5-bromo-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]phenyl]pyridine-2-carboxylate (PubChem CID 69455323) has the molecular formula C23H19BrNNaO4 and a molecular weight of 476.30 g/mol. Its IUPAC name is sodium 6-[2-[5-bromo-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]phenyl]pyridine-2-carboxylate.
| Compound Name | sodium 6-[2-[5-bromo-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 69455323 |
| Molecular Formula | C23H19BrNNaO4 |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | sodium 6-[2-[5-bromo-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]phenyl]pyridine-2-carboxylate |
| SMILES | O=C([O-])c1cccc(-c2ccccc2-c2cc(Br)ccc2OC[C@H]2CCOC2)n1.[Na+] |
| InChI | InChI=1S/C23H20BrNO4.Na/c24-16-8-9-22(29-14-15-10-11-28-13-15)19(12-16)17-4-1-2-5-18(17)20-6-3-7-21(25-20)23(26)27;/h1-9,12,15H,10-11,13-14H2,(H,26,27);/q;+1/p-1/t15-;/m0./s1 |
| InChIKey | RSRXSBDFKAEZAX-RSAXXLAASA-M |
| XLogP | 0.96 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |