C26H23ClN2O7 — CID 69455527
4-(2-chlorophenyl)-6-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-5-methoxycarbonyl-2-methyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 69455527) has the molecular formula C26H23ClN2O7 and a molecular weight of 510.93 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-6-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-5-methoxycarbonyl-2-methyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 4-(2-chlorophenyl)-6-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-5-methoxycarbonyl-2-methyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 69455527 |
| Molecular Formula | C26H23ClN2O7 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 4-(2-chlorophenyl)-6-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-5-methoxycarbonyl-2-methyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | COC(=O)C1=C(COCCN2C(=O)c3ccccc3C2=O)NC(C)=C(C(=O)O)C1c1ccccc1Cl |
| InChI | InChI=1S/C26H23ClN2O7/c1-14-20(25(32)33)21(17-9-5-6-10-18(17)27)22(26(34)35-2)19(28-14)13-36-12-11-29-23(30)15-7-3-4-8-16(15)24(29)31/h3-10,21,28H,11-13H2,1-2H3,(H,32,33) |
| InChIKey | GAVCFXLGTNNNKP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|