About cyclopentyl N-pyridin-3-ylcarbamate
cyclopentyl N-pyridin-3-ylcarbamate (PubChem CID 694562) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is cyclopentyl N-pyridin-3-ylcarbamate.
Molecular Properties
| Compound Name | cyclopentyl N-pyridin-3-ylcarbamate |
| PubChem CID | 694562 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | cyclopentyl N-pyridin-3-ylcarbamate |
| SMILES | O=C(Nc1cccnc1)OC1CCCC1 |
| InChI | InChI=1S/C11H14N2O2/c14-11(15-10-5-1-2-6-10)13-9-4-3-7-12-8-9/h3-4,7-8,10H,1-2,5-6H2,(H,13,14) |
| InChIKey | WDNPBNYZABVWBS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl N-pyridin-3-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl N-pyridin-3-ylcarbamate?
The IUPAC name of cyclopentyl N-pyridin-3-ylcarbamate (CID 694562) is cyclopentyl N-pyridin-3-ylcarbamate.
What is the SMILES notation for cyclopentyl N-pyridin-3-ylcarbamate?
The canonical SMILES for cyclopentyl N-pyridin-3-ylcarbamate is O=C(Nc1cccnc1)OC1CCCC1.
What is the InChIKey of cyclopentyl N-pyridin-3-ylcarbamate?
The InChIKey is WDNPBNYZABVWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c14-11(15-10-5-1-2-6-10)13-9-4-3-7-12-8-9/h3-4,7-8,10H,1-2,5-6H2,(H,13,14).
What are the key properties of cyclopentyl N-pyridin-3-ylcarbamate?
cyclopentyl N-pyridin-3-ylcarbamate has a molecular weight of 206.25 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl N-pyridin-3-ylcarbamate is sourced from PubChem (CID 694562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).