C9H11N5O2 — CID 69458072
2-amino-4-(1-hydroxypropyl)-8H-pteridin-7-one (PubChem CID 69458072) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-amino-4-(1-hydroxypropyl)-8H-pteridin-7-one.
| Compound Name | 2-amino-4-(1-hydroxypropyl)-8H-pteridin-7-one |
|---|---|
| PubChem CID | 69458072 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-amino-4-(1-hydroxypropyl)-8H-pteridin-7-one |
| SMILES | CCC(O)c1nc(N)nc2[nH]c(=O)cnc12 |
| InChI | InChI=1S/C9H11N5O2/c1-2-4(15)6-7-8(14-9(10)13-6)12-5(16)3-11-7/h3-4,15H,2H2,1H3,(H3,10,12,13,14,16) |
| InChIKey | QOYQTWFEFQPLMK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |