C18H18NO5- — CID 6945837
2-[[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]carbamoyl]benzoate (PubChem CID 6945837) has the molecular formula C18H18NO5- and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-[[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]carbamoyl]benzoate.
| Compound Name | 2-[[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 6945837 |
| Molecular Formula | C18H18NO5- |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]carbamoyl]benzoate |
| SMILES | Cc1ccc(OC[C@H](O)CNC(=O)c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H19NO5/c1-12-6-8-14(9-7-12)24-11-13(20)10-19-17(21)15-4-2-3-5-16(15)18(22)23/h2-9,13,20H,10-11H2,1H3,(H,19,21)(H,22,23)/p-1/t13-/m1/s1 |
| InChIKey | NRYSQFHPXLNFCA-CYBMUJFWSA-M |
| XLogP | 0.53 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |