C18H20FNO3 — CID 51089018
N-[3-(3-fluorophenoxy)-2-hydroxypropyl]-2,3-dimethylbenzamide (PubChem CID 51089018) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[3-(3-fluorophenoxy)-2-hydroxypropyl]-2,3-dimethylbenzamide.
| Compound Name | N-[3-(3-fluorophenoxy)-2-hydroxypropyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 51089018 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[3-(3-fluorophenoxy)-2-hydroxypropyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NCC(O)COc2cccc(F)c2)c1C |
| InChI | InChI=1S/C18H20FNO3/c1-12-5-3-8-17(13(12)2)18(22)20-10-15(21)11-23-16-7-4-6-14(19)9-16/h3-9,15,21H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | LWQJVVJPLJYUBI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |