C16H19FN2O3S — CID 94029464
1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-[(1R)-1-thiophen-2-ylethyl]urea (PubChem CID 94029464) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-[(1R)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-[(1R)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 94029464 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-[(1R)-1-thiophen-2-ylethyl]urea |
| SMILES | C[C@@H](NC(=O)NC[C@H](O)COc1cccc(F)c1)c1cccs1 |
| InChI | InChI=1S/C16H19FN2O3S/c1-11(15-6-3-7-23-15)19-16(21)18-9-13(20)10-22-14-5-2-4-12(17)8-14/h2-8,11,13,20H,9-10H2,1H3,(H2,18,19,21)/t11-,13+/m1/s1 |
| InChIKey | QTLFSWLEBUWBQK-YPMHNXCESA-N |
| XLogP | 2.69 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |