C16H18FN3O4 — CID 94031147
1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-(2-methoxy-3-pyridinyl)urea (PubChem CID 94031147) has the molecular formula C16H18FN3O4 and a molecular weight of 335.34 g/mol. Its IUPAC name is 1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-(2-methoxy-3-pyridinyl)urea.
| Compound Name | 1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-(2-methoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 94031147 |
| Molecular Formula | C16H18FN3O4 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[(2S)-3-(3-fluorophenoxy)-2-hydroxypropyl]-3-(2-methoxy-3-pyridinyl)urea |
| SMILES | COc1ncccc1NC(=O)NC[C@H](O)COc1cccc(F)c1 |
| InChI | InChI=1S/C16H18FN3O4/c1-23-15-14(6-3-7-18-15)20-16(22)19-9-12(21)10-24-13-5-2-4-11(17)8-13/h2-8,12,21H,9-10H2,1H3,(H2,19,20,22)/t12-/m0/s1 |
| InChIKey | JSLGAFICYGOLHE-LBPRGKRZSA-N |
| XLogP | 1.79 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |