C18H24N2O3S — CID 110904600
1-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(1-thiophen-2-ylpropan-2-yl)urea (PubChem CID 110904600) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(1-thiophen-2-ylpropan-2-yl)urea.
| Compound Name | 1-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(1-thiophen-2-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 110904600 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-(1-thiophen-2-ylpropan-2-yl)urea |
| SMILES | Cc1cccc(OCC(O)CNC(=O)NC(C)Cc2cccs2)c1 |
| InChI | InChI=1S/C18H24N2O3S/c1-13-5-3-6-16(9-13)23-12-15(21)11-19-18(22)20-14(2)10-17-7-4-8-24-17/h3-9,14-15,21H,10-12H2,1-2H3,(H2,19,20,22) |
| InChIKey | NSGVCZNEEMYEFS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |