C17H15N3S — CID 69458449
4-[(1-methylindol-3-yl)methyl]-1,3-dihydrobenzimidazole-2-thione (PubChem CID 69458449) has the molecular formula C17H15N3S and a molecular weight of 293.40 g/mol. Its IUPAC name is 4-[(1-methylindol-3-yl)methyl]-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 4-[(1-methylindol-3-yl)methyl]-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 69458449 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-[(1-methylindol-3-yl)methyl]-1,3-dihydrobenzimidazole-2-thione |
| SMILES | Cn1cc(Cc2cccc3[nH]c(=S)[nH]c23)c2ccccc21 |
| InChI | InChI=1S/C17H15N3S/c1-20-10-12(13-6-2-3-8-15(13)20)9-11-5-4-7-14-16(11)19-17(21)18-14/h2-8,10H,9H2,1H3,(H2,18,19,21) |
| InChIKey | FRKPGAIQPCCMAT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 36.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|