C22H31NO9 — CID 69460853
2-hydroxy-2-[2-[4-(6-morpholin-4-ylhexoxy)phenoxy]-2-oxoethyl]butanedioic acid (PubChem CID 69460853) has the molecular formula C22H31NO9 and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-hydroxy-2-[2-[4-(6-morpholin-4-ylhexoxy)phenoxy]-2-oxoethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-[4-(6-morpholin-4-ylhexoxy)phenoxy]-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 69460853 |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-hydroxy-2-[2-[4-(6-morpholin-4-ylhexoxy)phenoxy]-2-oxoethyl]butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)Oc1ccc(OCCCCCCN2CCOCC2)cc1)C(=O)O |
| InChI | InChI=1S/C22H31NO9/c24-19(25)15-22(29,21(27)28)16-20(26)32-18-7-5-17(6-8-18)31-12-4-2-1-3-9-23-10-13-30-14-11-23/h5-8,29H,1-4,9-16H2,(H,24,25)(H,27,28) |
| InChIKey | VGOSSFQCTRTTKM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|