C34H35N3O3S — CID 69464896
2-[2-[3-[benzyl(3,3-diphenylpropanoyl)amino]propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid (PubChem CID 69464896) has the molecular formula C34H35N3O3S and a molecular weight of 565.74 g/mol. Its IUPAC name is 2-[2-[3-[benzyl(3,3-diphenylpropanoyl)amino]propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid.
| Compound Name | 2-[2-[3-[benzyl(3,3-diphenylpropanoyl)amino]propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 69464896 |
| Molecular Formula | C34H35N3O3S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 2-[2-[3-[benzyl(3,3-diphenylpropanoyl)amino]propylsulfanyl]-1,3-dihydrobenzimidazol-2-yl]acetic acid |
| SMILES | O=C(O)CC1(SCCCN(Cc2ccccc2)C(=O)CC(c2ccccc2)c2ccccc2)Nc2ccccc2N1 |
| InChI | InChI=1S/C34H35N3O3S/c38-32(23-29(27-15-6-2-7-16-27)28-17-8-3-9-18-28)37(25-26-13-4-1-5-14-26)21-12-22-41-34(24-33(39)40)35-30-19-10-11-20-31(30)36-34/h1-11,13-20,29,35-36H,12,21-25H2,(H,39,40) |
| InChIKey | QOHMGJDFMKGDAH-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|