C19H25N3O3S — CID 69466089
2-[2-(2-oxo-1-piperidin-3-ylpentyl)sulfanylbenzimidazol-1-yl]acetic acid (PubChem CID 69466089) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[2-(2-oxo-1-piperidin-3-ylpentyl)sulfanylbenzimidazol-1-yl]acetic acid.
| Compound Name | 2-[2-(2-oxo-1-piperidin-3-ylpentyl)sulfanylbenzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 69466089 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[2-(2-oxo-1-piperidin-3-ylpentyl)sulfanylbenzimidazol-1-yl]acetic acid |
| SMILES | CCCC(=O)C(Sc1nc2ccccc2n1CC(=O)O)C1CCCNC1 |
| InChI | InChI=1S/C19H25N3O3S/c1-2-6-16(23)18(13-7-5-10-20-11-13)26-19-21-14-8-3-4-9-15(14)22(19)12-17(24)25/h3-4,8-9,13,18,20H,2,5-7,10-12H2,1H3,(H,24,25) |
| InChIKey | WGNHNNLLTDVZLE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |