C36H34N4O4 — CID 69466976
3-(4-pyridin-3-ylphenoxy)propan-1-amine;2-[3-(3-pyridin-3-ylphenoxy)propyl]isoindole-1,3-dione (PubChem CID 69466976) has the molecular formula C36H34N4O4 and a molecular weight of 586.69 g/mol. Its IUPAC name is 3-(4-pyridin-3-ylphenoxy)propan-1-amine;2-[3-(3-pyridin-3-ylphenoxy)propyl]isoindole-1,3-dione.
| Compound Name | 3-(4-pyridin-3-ylphenoxy)propan-1-amine;2-[3-(3-pyridin-3-ylphenoxy)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 69466976 |
| Molecular Formula | C36H34N4O4 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 3-(4-pyridin-3-ylphenoxy)propan-1-amine;2-[3-(3-pyridin-3-ylphenoxy)propyl]isoindole-1,3-dione |
| SMILES | NCCCOc1ccc(-c2cccnc2)cc1.O=C1c2ccccc2C(=O)N1CCCOc1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C22H18N2O3.C14H16N2O/c25-21-19-9-1-2-10-20(19)22(26)24(21)12-5-13-27-18-8-3-6-16(14-18)17-7-4-11-23-15-17;15-8-2-10-17-14-6-4-12(5-7-14)13-3-1-9-16-11-13/h1-4,6-11,14-15H,5,12-13H2;1,3-7,9,11H,2,8,10,15H2 |
| InChIKey | UMPNBQXFNNPTEQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|