C24H27NO5 — CID 69467018
ethyl 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-4-(4-propan-2-ylphenyl)-1H-indole-3-carboxylate (PubChem CID 69467018) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-4-(4-propan-2-ylphenyl)-1H-indole-3-carboxylate.
| Compound Name | ethyl 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-4-(4-propan-2-ylphenyl)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 69467018 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | ethyl 2-(2-ethoxy-2-oxoethyl)-5-hydroxy-4-(4-propan-2-ylphenyl)-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)Cc1[nH]c2ccc(O)c(-c3ccc(C(C)C)cc3)c2c1C(=O)OCC |
| InChI | InChI=1S/C24H27NO5/c1-5-29-20(27)13-18-23(24(28)30-6-2)22-17(25-18)11-12-19(26)21(22)16-9-7-15(8-10-16)14(3)4/h7-12,14,25-26H,5-6,13H2,1-4H3 |
| InChIKey | CDFCQTQAXVGVHU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |