C23H30N4O2 — CID 69468918
3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]-N-methyl-N-[3-(methylamino)propyl]propanamide (PubChem CID 69468918) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]-N-methyl-N-[3-(methylamino)propyl]propanamide.
| Compound Name | 3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]-N-methyl-N-[3-(methylamino)propyl]propanamide |
|---|---|
| PubChem CID | 69468918 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 3-[2,4-dimethyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]-N-methyl-N-[3-(methylamino)propyl]propanamide |
| SMILES | CNCCCN(C)C(=O)CCc1c(C)[nH]c(/C=C2\C(=O)Nc3ccccc32)c1C |
| InChI | InChI=1S/C23H30N4O2/c1-15-17(10-11-22(28)27(4)13-7-12-24-3)16(2)25-21(15)14-19-18-8-5-6-9-20(18)26-23(19)29/h5-6,8-9,14,24-25H,7,10-13H2,1-4H3,(H,26,29)/b19-14- |
| InChIKey | DKNSOFNGKYCMIR-RGEXLXHISA-N |
| XLogP | 3.12 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|