C23H29NO6 — CID 69469293
5-[[4-(6-hydroxyhexyl)phenyl]-[[(2R)-5-oxopyrrolidin-2-yl]methoxy]methyl]furan-2-carboxylic acid (PubChem CID 69469293) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 5-[[4-(6-hydroxyhexyl)phenyl]-[[(2R)-5-oxopyrrolidin-2-yl]methoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-(6-hydroxyhexyl)phenyl]-[[(2R)-5-oxopyrrolidin-2-yl]methoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 69469293 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 5-[[4-(6-hydroxyhexyl)phenyl]-[[(2R)-5-oxopyrrolidin-2-yl]methoxy]methyl]furan-2-carboxylic acid |
| SMILES | O=C1CC[C@H](COC(c2ccc(CCCCCCO)cc2)c2ccc(C(=O)O)o2)N1 |
| InChI | InChI=1S/C23H29NO6/c25-14-4-2-1-3-5-16-6-8-17(9-7-16)22(19-11-12-20(30-19)23(27)28)29-15-18-10-13-21(26)24-18/h6-9,11-12,18,22,25H,1-5,10,13-15H2,(H,24,26)(H,27,28)/t18-,22?/m1/s1 |
| InChIKey | LBKPTYRLFXNQLH-ZZWBGTBQSA-N |
| XLogP | 3.46 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|