C27H34N2O2 — CID 69470448
N-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)methyl]-2-hydroxy-2-phenylhex-4-enamide (PubChem CID 69470448) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)methyl]-2-hydroxy-2-phenylhex-4-enamide.
| Compound Name | N-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)methyl]-2-hydroxy-2-phenylhex-4-enamide |
|---|---|
| PubChem CID | 69470448 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-[(3-benzyl-3-azabicyclo[3.2.1]octan-8-yl)methyl]-2-hydroxy-2-phenylhex-4-enamide |
| SMILES | CC=CCC(O)(C(=O)NCC1C2CCC1CN(Cc1ccccc1)C2)c1ccccc1 |
| InChI | InChI=1S/C27H34N2O2/c1-2-3-16-27(31,24-12-8-5-9-13-24)26(30)28-17-25-22-14-15-23(25)20-29(19-22)18-21-10-6-4-7-11-21/h2-13,22-23,25,31H,14-20H2,1H3,(H,28,30) |
| InChIKey | WHRZLQBFMRSMLI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|