C13H17BrNOS+ — CID 6947057
(5-bromo-1-benzothiophen-3-yl)methyl-ethyl-(2-hydroxyethyl)azanium (PubChem CID 6947057) has the molecular formula C13H17BrNOS+ and a molecular weight of 315.26 g/mol. Its IUPAC name is (5-bromo-1-benzothiophen-3-yl)methyl-ethyl-(2-hydroxyethyl)azanium.
| Compound Name | (5-bromo-1-benzothiophen-3-yl)methyl-ethyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 6947057 |
| Molecular Formula | C13H17BrNOS+ |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (5-bromo-1-benzothiophen-3-yl)methyl-ethyl-(2-hydroxyethyl)azanium |
| SMILES | CC[NH+](CCO)Cc1csc2ccc(Br)cc12 |
| InChI | InChI=1S/C13H16BrNOS/c1-2-15(5-6-16)8-10-9-17-13-4-3-11(14)7-12(10)13/h3-4,7,9,16H,2,5-6,8H2,1H3/p+1 |
| InChIKey | QLDCYLXQWZJOHQ-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |