C12H15BrNOS+ — CID 6947090
(5-bromo-1-benzothiophen-3-yl)methyl-(2-hydroxyethyl)-methylazanium (PubChem CID 6947090) has the molecular formula C12H15BrNOS+ and a molecular weight of 301.23 g/mol. Its IUPAC name is (5-bromo-1-benzothiophen-3-yl)methyl-(2-hydroxyethyl)-methylazanium.
| Compound Name | (5-bromo-1-benzothiophen-3-yl)methyl-(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 6947090 |
| Molecular Formula | C12H15BrNOS+ |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | (5-bromo-1-benzothiophen-3-yl)methyl-(2-hydroxyethyl)-methylazanium |
| SMILES | C[NH+](CCO)Cc1csc2ccc(Br)cc12 |
| InChI | InChI=1S/C12H14BrNOS/c1-14(4-5-15)7-9-8-16-12-3-2-10(13)6-11(9)12/h2-3,6,8,15H,4-5,7H2,1H3/p+1 |
| InChIKey | JXPVCNGSANTUCF-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |