C15H13N5OS — CID 69471057
[3-[(5-thiophen-3-ylpyrimidin-2-yl)amino]phenyl]urea (PubChem CID 69471057) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is [3-[(5-thiophen-3-ylpyrimidin-2-yl)amino]phenyl]urea.
| Compound Name | [3-[(5-thiophen-3-ylpyrimidin-2-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 69471057 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [3-[(5-thiophen-3-ylpyrimidin-2-yl)amino]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(Nc2ncc(-c3ccsc3)cn2)c1 |
| InChI | InChI=1S/C15H13N5OS/c16-14(21)19-12-2-1-3-13(6-12)20-15-17-7-11(8-18-15)10-4-5-22-9-10/h1-9H,(H3,16,19,21)(H,17,18,20) |
| InChIKey | YGBJNRNBSWNZEW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |