C17H19NO4 — CID 69471549
2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 69471549) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | 2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 69471549 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | COc1ccc(N2CCc3cc(O)c(OC)cc3C2)cc1O |
| InChI | InChI=1S/C17H19NO4/c1-21-16-4-3-13(9-15(16)20)18-6-5-11-7-14(19)17(22-2)8-12(11)10-18/h3-4,7-9,19-20H,5-6,10H2,1-2H3 |
| InChIKey | ISEHSHMBUDBWKI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|