C15H11F4NO2 — CID 69473783
2-[[(2,3-difluoro-4-methylphenyl)-difluoromethyl]amino]benzoic acid (PubChem CID 69473783) has the molecular formula C15H11F4NO2 and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-[[(2,3-difluoro-4-methylphenyl)-difluoromethyl]amino]benzoic acid.
| Compound Name | 2-[[(2,3-difluoro-4-methylphenyl)-difluoromethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 69473783 |
| Molecular Formula | C15H11F4NO2 |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[(2,3-difluoro-4-methylphenyl)-difluoromethyl]amino]benzoic acid |
| SMILES | Cc1ccc(C(F)(F)Nc2ccccc2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C15H11F4NO2/c1-8-6-7-10(13(17)12(8)16)15(18,19)20-11-5-3-2-4-9(11)14(21)22/h2-7,20H,1H3,(H,21,22) |
| InChIKey | SHSDXQRCCQZSPP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|