About 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid
2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid (PubChem CID 69474466) has the molecular formula C21H34N2O4
and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid |
| PubChem CID | 69474466 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid |
| SMILES | CCc1c(C)cc(C(=O)NC(CC(C)(C)C)C(=O)O)c(=O)n1CCC(C)C |
| InChI | InChI=1S/C21H34N2O4/c1-8-17-14(4)11-15(19(25)23(17)10-9-13(2)3)18(24)22-16(20(26)27)12-21(5,6)7/h11,13,16H,8-10,12H2,1-7H3,(H,22,24)(H,26,27) |
| InChIKey | SPZPGCYDYJCHFX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid?
The IUPAC name of 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid (CID 69474466) is 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid is CCc1c(C)cc(C(=O)NC(CC(C)(C)C)C(=O)O)c(=O)n1CCC(C)C.
What is the InChIKey of 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid?
The InChIKey is SPZPGCYDYJCHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O4/c1-8-17-14(4)11-15(19(25)23(17)10-9-13(2)3)18(24)22-16(20(26)27)12-21(5,6)7/h11,13,16H,8-10,12H2,1-7H3,(H,22,24)(H,26,27).
What are the key properties of 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid?
2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid has a molecular weight of 378.51 g/mol, XLogP of 3.38, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-ethyl-5-methyl-1-(3-methylbutyl)-2-oxopyridine-3-carbonyl]amino]-4,4-dimethylpentanoic acid is sourced from PubChem (CID 69474466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).