About 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid
2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid (PubChem CID 150762523) has the molecular formula C19H30N2O4
and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid |
| PubChem CID | 150762523 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid |
| SMILES | CCCCn1c(CC)c(C)cc(C(=O)NC(C)(C(=O)O)C(C)C)c1=O |
| InChI | InChI=1S/C19H30N2O4/c1-7-9-10-21-15(8-2)13(5)11-14(17(21)23)16(22)20-19(6,12(3)4)18(24)25/h11-12H,7-10H2,1-6H3,(H,20,22)(H,24,25) |
| InChIKey | JYDBKERRXBINNB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid?
The IUPAC name of 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid (CID 150762523) is 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid.
What is the SMILES notation for 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid?
The canonical SMILES for 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid is CCCCn1c(CC)c(C)cc(C(=O)NC(C)(C(=O)O)C(C)C)c1=O.
What is the InChIKey of 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid?
The InChIKey is JYDBKERRXBINNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O4/c1-7-9-10-21-15(8-2)13(5)11-14(17(21)23)16(22)20-19(6,12(3)4)18(24)25/h11-12H,7-10H2,1-6H3,(H,20,22)(H,24,25).
What are the key properties of 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid?
2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid has a molecular weight of 350.46 g/mol, XLogP of 2.75, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-butyl-6-ethyl-5-methyl-2-oxopyridine-3-carbonyl)amino]-2,3-dimethylbutanoic acid is sourced from PubChem (CID 150762523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).