C20H29ClN2O4 — CID 142970361
1-butyl-6-[(E)-2-chloroprop-1-enyl]-N-[1-(dihydroxymethyl)cyclopentyl]-5-methyl-2-oxopyridine-3-carboxamide (PubChem CID 142970361) has the molecular formula C20H29ClN2O4 and a molecular weight of 396.92 g/mol. Its IUPAC name is 1-butyl-6-[(E)-2-chloroprop-1-enyl]-N-[1-(dihydroxymethyl)cyclopentyl]-5-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | 1-butyl-6-[(E)-2-chloroprop-1-enyl]-N-[1-(dihydroxymethyl)cyclopentyl]-5-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 142970361 |
| Molecular Formula | C20H29ClN2O4 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-butyl-6-[(E)-2-chloroprop-1-enyl]-N-[1-(dihydroxymethyl)cyclopentyl]-5-methyl-2-oxopyridine-3-carboxamide |
| SMILES | CCCCn1c(/C=C(\C)Cl)c(C)cc(C(=O)NC2(C(O)O)CCCC2)c1=O |
| InChI | InChI=1S/C20H29ClN2O4/c1-4-5-10-23-16(12-14(3)21)13(2)11-15(18(23)25)17(24)22-20(19(26)27)8-6-7-9-20/h11-12,19,26-27H,4-10H2,1-3H3,(H,22,24)/b14-12+ |
| InChIKey | UZCAFLLJQZCWBK-WYMLVPIESA-N |
| XLogP | 2.91 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|