C25H34N2O5 — CID 142970273
1-[(7-methoxy-2-oxo-1-pentylquinoline-3-carbonyl)amino]cyclooctane-1-carboxylic acid (PubChem CID 142970273) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxo-1-pentylquinoline-3-carbonyl)amino]cyclooctane-1-carboxylic acid.
| Compound Name | 1-[(7-methoxy-2-oxo-1-pentylquinoline-3-carbonyl)amino]cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 142970273 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 1-[(7-methoxy-2-oxo-1-pentylquinoline-3-carbonyl)amino]cyclooctane-1-carboxylic acid |
| SMILES | CCCCCn1c(=O)c(C(=O)NC2(C(=O)O)CCCCCCC2)cc2ccc(OC)cc21 |
| InChI | InChI=1S/C25H34N2O5/c1-3-4-10-15-27-21-17-19(32-2)12-11-18(21)16-20(23(27)29)22(28)26-25(24(30)31)13-8-6-5-7-9-14-25/h11-12,16-17H,3-10,13-15H2,1-2H3,(H,26,28)(H,30,31) |
| InChIKey | LHFYPCRBSZVGNI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|