C23H30N2O5 — CID 142970265
methyl 1-[(7-methoxy-2-oxo-1-propylquinoline-3-carbonyl)amino]cycloheptane-1-carboxylate (PubChem CID 142970265) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl 1-[(7-methoxy-2-oxo-1-propylquinoline-3-carbonyl)amino]cycloheptane-1-carboxylate.
| Compound Name | methyl 1-[(7-methoxy-2-oxo-1-propylquinoline-3-carbonyl)amino]cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 142970265 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl 1-[(7-methoxy-2-oxo-1-propylquinoline-3-carbonyl)amino]cycloheptane-1-carboxylate |
| SMILES | CCCn1c(=O)c(C(=O)NC2(C(=O)OC)CCCCCC2)cc2ccc(OC)cc21 |
| InChI | InChI=1S/C23H30N2O5/c1-4-13-25-19-15-17(29-2)10-9-16(19)14-18(21(25)27)20(26)24-23(22(28)30-3)11-7-5-6-8-12-23/h9-10,14-15H,4-8,11-13H2,1-3H3,(H,24,26) |
| InChIKey | LEHKLORNSFJGFB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |