C26H30N2O3 — CID 142970389
3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-hexyl-7-methoxyquinolin-2-one (PubChem CID 142970389) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-hexyl-7-methoxyquinolin-2-one.
| Compound Name | 3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-hexyl-7-methoxyquinolin-2-one |
|---|---|
| PubChem CID | 142970389 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-1-hexyl-7-methoxyquinolin-2-one |
| SMILES | CCCCCCn1c(=O)c(C(=O)N2CCc3ccccc3C2)cc2ccc(OC)cc21 |
| InChI | InChI=1S/C26H30N2O3/c1-3-4-5-8-14-28-24-17-22(31-2)12-11-20(24)16-23(26(28)30)25(29)27-15-13-19-9-6-7-10-21(19)18-27/h6-7,9-12,16-17H,3-5,8,13-15,18H2,1-2H3 |
| InChIKey | DWFHFPUTKUUARW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|