C28H35N3O7S — CID 69474662
N-[(3S)-1-(benzylamino)-1,2-dioxopentan-3-yl]-2-[methylsulfonyl(phenyl)methyl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 69474662) has the molecular formula C28H35N3O7S and a molecular weight of 557.67 g/mol. Its IUPAC name is N-[(3S)-1-(benzylamino)-1,2-dioxopentan-3-yl]-2-[methylsulfonyl(phenyl)methyl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | N-[(3S)-1-(benzylamino)-1,2-dioxopentan-3-yl]-2-[methylsulfonyl(phenyl)methyl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 69474662 |
| Molecular Formula | C28H35N3O7S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | N-[(3S)-1-(benzylamino)-1,2-dioxopentan-3-yl]-2-[methylsulfonyl(phenyl)methyl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | CC[C@H](NC(=O)C(CC(=O)N1CCOCC1)C(c1ccccc1)S(C)(=O)=O)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H35N3O7S/c1-3-23(25(33)28(35)29-19-20-10-6-4-7-11-20)30-27(34)22(18-24(32)31-14-16-38-17-15-31)26(39(2,36)37)21-12-8-5-9-13-21/h4-13,22-23,26H,3,14-19H2,1-2H3,(H,29,35)(H,30,34)/t22?,23-,26?/m0/s1 |
| InChIKey | LOEWREUYCKRUIR-SBRHDKPSSA-N |
| XLogP | 1.42 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|