C21H27NO4Si — CID 69475126
methyl 3-[benzyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 69475126) has the molecular formula C21H27NO4Si and a molecular weight of 385.54 g/mol. Its IUPAC name is methyl 3-[benzyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl 3-[benzyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 69475126 |
| Molecular Formula | C21H27NO4Si |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | methyl 3-[benzyl(dimethyl)silyl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)C(C[Si](C)(C)Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO4Si/c1-25-20(23)19(16-27(2,3)15-18-12-8-5-9-13-18)22-21(24)26-14-17-10-6-4-7-11-17/h4-13,19H,14-16H2,1-3H3,(H,22,24) |
| InChIKey | QXAUWJIHTJWZHP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|