C22H38O4 — CID 69476975
6-(2,11-dimethyldodecan-3-yloxycarbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 69476975) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 6-(2,11-dimethyldodecan-3-yloxycarbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(2,11-dimethyldodecan-3-yloxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 69476975 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 6-(2,11-dimethyldodecan-3-yloxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)CCCCCCCC(OC(=O)C1CC=CCC1C(=O)O)C(C)C |
| InChI | InChI=1S/C22H38O4/c1-16(2)12-8-6-5-7-9-15-20(17(3)4)26-22(25)19-14-11-10-13-18(19)21(23)24/h10-11,16-20H,5-9,12-15H2,1-4H3,(H,23,24) |
| InChIKey | JIHRYNIVAVEFOQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|