C14H12FN3O2S — CID 6948295
methyl (3R,4R)-6-amino-5-cyano-4-(4-fluorophenyl)-2-imino-3,4-dihydrothiopyran-3-carboxylate (PubChem CID 6948295) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is methyl (3R,4R)-6-amino-5-cyano-4-(4-fluorophenyl)-2-imino-3,4-dihydrothiopyran-3-carboxylate.
| Compound Name | methyl (3R,4R)-6-amino-5-cyano-4-(4-fluorophenyl)-2-imino-3,4-dihydrothiopyran-3-carboxylate |
|---|---|
| PubChem CID | 6948295 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | methyl (3R,4R)-6-amino-5-cyano-4-(4-fluorophenyl)-2-imino-3,4-dihydrothiopyran-3-carboxylate |
| SMILES | [H]/N=C1\SC(N)=C(C#N)[C@@H](c2ccc(F)cc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C14H12FN3O2S/c1-20-14(19)11-10(7-2-4-8(15)5-3-7)9(6-16)12(17)21-13(11)18/h2-5,10-11,18H,17H2,1H3/b18-13-/t10-,11+/m1/s1 |
| InChIKey | CVJMVIPBFUDOGL-IEVFTTQPSA-N |
| XLogP | 2.12 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|