C13H9N5O2S — CID 7068825
(3R,4S)-6-amino-2-imino-4-(4-nitrophenyl)-3,4-dihydrothiopyran-3,5-dicarbonitrile (PubChem CID 7068825) has the molecular formula C13H9N5O2S and a molecular weight of 299.32 g/mol. Its IUPAC name is (3R,4S)-6-amino-2-imino-4-(4-nitrophenyl)-3,4-dihydrothiopyran-3,5-dicarbonitrile.
| Compound Name | (3R,4S)-6-amino-2-imino-4-(4-nitrophenyl)-3,4-dihydrothiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 7068825 |
| Molecular Formula | C13H9N5O2S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (3R,4S)-6-amino-2-imino-4-(4-nitrophenyl)-3,4-dihydrothiopyran-3,5-dicarbonitrile |
| SMILES | [H]/N=C1\SC(N)=C(C#N)[C@H](c2ccc([N+](=O)[O-])cc2)[C@@H]1C#N |
| InChI | InChI=1S/C13H9N5O2S/c14-5-9-11(10(6-15)13(17)21-12(9)16)7-1-3-8(4-2-7)18(19)20/h1-4,9,11,16H,17H2/b16-12-/t9-,11+/m0/s1 |
| InChIKey | SPUTXWNRJBRUAM-ZTZWZQOXSA-N |
| XLogP | 2.24 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|