C21H17N5O8 — CID 102427797
methyl 2-amino-3-cyano-5-nitro-4,6-bis(4-nitrophenyl)cyclohexene-1-carboxylate (PubChem CID 102427797) has the molecular formula C21H17N5O8 and a molecular weight of 467.39 g/mol. Its IUPAC name is methyl 2-amino-3-cyano-5-nitro-4,6-bis(4-nitrophenyl)cyclohexene-1-carboxylate.
| Compound Name | methyl 2-amino-3-cyano-5-nitro-4,6-bis(4-nitrophenyl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102427797 |
| Molecular Formula | C21H17N5O8 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | methyl 2-amino-3-cyano-5-nitro-4,6-bis(4-nitrophenyl)cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(N)C(C#N)C(c2ccc([N+](=O)[O-])cc2)C([N+](=O)[O-])C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N5O8/c1-34-21(27)18-17(12-4-8-14(9-5-12)25(30)31)20(26(32)33)16(15(10-22)19(18)23)11-2-6-13(7-3-11)24(28)29/h2-9,15-17,20H,23H2,1H3 |
| InChIKey | ZIEGPVVQIHIQSI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 205.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|