C19H17Cl2N7O2S — CID 6326323
N'-[6-[(Z)-[chloro(dimethylamino)methylidene]amino]-3,5-dicyano-4-(4-nitrophenyl)-4H-thiopyran-2-yl]-N,N-dimethylcarbamimidoyl chloride (PubChem CID 6326323) has the molecular formula C19H17Cl2N7O2S and a molecular weight of 478.37 g/mol. Its IUPAC name is N'-[6-[(Z)-[chloro(dimethylamino)methylidene]amino]-3,5-dicyano-4-(4-nitrophenyl)-4H-thiopyran-2-yl]-N,N-dimethylcarbamimidoyl chloride.
| Compound Name | N'-[6-[(Z)-[chloro(dimethylamino)methylidene]amino]-3,5-dicyano-4-(4-nitrophenyl)-4H-thiopyran-2-yl]-N,N-dimethylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 6326323 |
| Molecular Formula | C19H17Cl2N7O2S |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | N'-[6-[(Z)-[chloro(dimethylamino)methylidene]amino]-3,5-dicyano-4-(4-nitrophenyl)-4H-thiopyran-2-yl]-N,N-dimethylcarbamimidoyl chloride |
| SMILES | CN(C)/C(Cl)=N/C1=C(C#N)C(c2ccc([N+](=O)[O-])cc2)C(C#N)=C(/N=C(/Cl)N(C)C)S1 |
| InChI | InChI=1S/C19H17Cl2N7O2S/c1-26(2)18(20)24-16-13(9-22)15(11-5-7-12(8-6-11)28(29)30)14(10-23)17(31-16)25-19(21)27(3)4/h5-8,15H,1-4H3/b24-18-,25-19+ |
| InChIKey | ZIKBXQWVPKFLDX-ZFQRDYFNSA-N |
| XLogP | 4.21 |
| TPSA | 121.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|