C15H16N4O4 — CID 102235371
5-amino-2-(2,2-dimethylpropanoyl)-3-(4-nitrophenyl)-3H-1,2-oxazole-4-carbonitrile (PubChem CID 102235371) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 5-amino-2-(2,2-dimethylpropanoyl)-3-(4-nitrophenyl)-3H-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-amino-2-(2,2-dimethylpropanoyl)-3-(4-nitrophenyl)-3H-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 102235371 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 5-amino-2-(2,2-dimethylpropanoyl)-3-(4-nitrophenyl)-3H-1,2-oxazole-4-carbonitrile |
| SMILES | CC(C)(C)C(=O)N1OC(N)=C(C#N)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H16N4O4/c1-15(2,3)14(20)18-12(11(8-16)13(17)23-18)9-4-6-10(7-5-9)19(21)22/h4-7,12H,17H2,1-3H3 |
| InChIKey | ASQNJNOWBZEOLB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|