C15H14N6O2S — CID 100933363
7-amino-2-methylsulfanyl-5-(4-nitrophenyl)-1,4,5,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 100933363) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 7-amino-2-methylsulfanyl-5-(4-nitrophenyl)-1,4,5,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 7-amino-2-methylsulfanyl-5-(4-nitrophenyl)-1,4,5,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 100933363 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 7-amino-2-methylsulfanyl-5-(4-nitrophenyl)-1,4,5,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CSC1=NCC2=C(N1)NC(N)=C(C#N)C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H14N6O2S/c1-24-15-18-7-11-12(8-2-4-9(5-3-8)21(22)23)10(6-16)13(17)19-14(11)20-15/h2-5,12,19H,7,17H2,1H3,(H,18,20) |
| InChIKey | DULPHOJVDJEPFA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|