C12H12N8O3S2 — CID 125115576
[[(2S,4E)-4-(carbamothioylhydrazinylidene)-5-imino-2-(4-nitrophenyl)oxolan-3-ylidene]amino]thiourea (PubChem CID 125115576) has the molecular formula C12H12N8O3S2 and a molecular weight of 380.42 g/mol. Its IUPAC name is [[(2S,4E)-4-(carbamothioylhydrazinylidene)-5-imino-2-(4-nitrophenyl)oxolan-3-ylidene]amino]thiourea.
| Compound Name | [[(2S,4E)-4-(carbamothioylhydrazinylidene)-5-imino-2-(4-nitrophenyl)oxolan-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 125115576 |
| Molecular Formula | C12H12N8O3S2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | [[(2S,4E)-4-(carbamothioylhydrazinylidene)-5-imino-2-(4-nitrophenyl)oxolan-3-ylidene]amino]thiourea |
| SMILES | [H]/N=C1\O[C@@H](c2ccc([N+](=O)[O-])cc2)C(=NNC(N)=S)\C1=N/NC(N)=S |
| InChI | InChI=1S/C12H12N8O3S2/c13-10-8(17-19-12(15)25)7(16-18-11(14)24)9(23-10)5-1-3-6(4-2-5)20(21)22/h1-4,9,13H,(H3,14,18,24)(H3,15,19,25)/b13-10-,16-7?,17-8+/t9-/m0/s1 |
| InChIKey | KIGYCYUGRCUVAQ-GRWLLPKHSA-N |
| XLogP | 0.02 |
| TPSA | 177.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|