C22H16N8O5 — CID 6818199
N-[[5-imino-2-(4-nitrophenyl)-4-(pyridine-4-carbonylhydrazinylidene)oxolan-3-ylidene]amino]pyridine-4-carboxamide (PubChem CID 6818199) has the molecular formula C22H16N8O5 and a molecular weight of 472.42 g/mol. Its IUPAC name is N-[[5-imino-2-(4-nitrophenyl)-4-(pyridine-4-carbonylhydrazinylidene)oxolan-3-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[[5-imino-2-(4-nitrophenyl)-4-(pyridine-4-carbonylhydrazinylidene)oxolan-3-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6818199 |
| Molecular Formula | C22H16N8O5 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-[[5-imino-2-(4-nitrophenyl)-4-(pyridine-4-carbonylhydrazinylidene)oxolan-3-ylidene]amino]pyridine-4-carboxamide |
| SMILES | [H]/N=C1\OC(c2ccc([N+](=O)[O-])cc2)C(=NNC(=O)c2ccncc2)C1=NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C22H16N8O5/c23-20-18(27-29-22(32)15-7-11-25-12-8-15)17(26-28-21(31)14-5-9-24-10-6-14)19(35-20)13-1-3-16(4-2-13)30(33)34/h1-12,19,23H,(H,28,31)(H,29,32)/b23-20-,26-17?,27-18? |
| InChIKey | WGIXMWVPVZQETH-UHUIKBAKSA-N |
| XLogP | 2.01 |
| TPSA | 184.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|