C23H18N8O7 — CID 98535397
N-[(E)-[(4R,5S)-2-imino-4-[2-(3-nitrobenzoyl)hydrazinyl]-5-pyridin-4-yloxolan-3-ylidene]amino]-3-nitrobenzamide (PubChem CID 98535397) has the molecular formula C23H18N8O7 and a molecular weight of 518.45 g/mol. Its IUPAC name is N-[(E)-[(4R,5S)-2-imino-4-[2-(3-nitrobenzoyl)hydrazinyl]-5-pyridin-4-yloxolan-3-ylidene]amino]-3-nitrobenzamide.
| Compound Name | N-[(E)-[(4R,5S)-2-imino-4-[2-(3-nitrobenzoyl)hydrazinyl]-5-pyridin-4-yloxolan-3-ylidene]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 98535397 |
| Molecular Formula | C23H18N8O7 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | N-[(E)-[(4R,5S)-2-imino-4-[2-(3-nitrobenzoyl)hydrazinyl]-5-pyridin-4-yloxolan-3-ylidene]amino]-3-nitrobenzamide |
| SMILES | [H]/N=C1\O[C@@H](c2ccncc2)[C@H](NNC(=O)c2cccc([N+](=O)[O-])c2)\C1=N/NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H18N8O7/c24-21-19(27-29-23(33)15-4-2-6-17(12-15)31(36)37)18(20(38-21)13-7-9-25-10-8-13)26-28-22(32)14-3-1-5-16(11-14)30(34)35/h1-12,18,20,24,26H,(H,28,32)(H,29,33)/b24-21-,27-19+/t18-,20+/m1/s1 |
| InChIKey | ITCBWYHRIUEALF-PDCHGOORSA-N |
| XLogP | 2.04 |
| TPSA | 214.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|